C26H29N3O2 — CID 18319843
N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-5,6,7,8-tetrahydroquinoline-8-carboxamide (PubChem CID 18319843) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-5,6,7,8-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-5,6,7,8-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 18319843 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-5,6,7,8-tetrahydroquinoline-8-carboxamide |
| SMILES | O=C(Nc1ccc(CCNCC(O)c2ccccc2)cc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C26H29N3O2/c30-24(20-6-2-1-3-7-20)18-27-17-15-19-11-13-22(14-12-19)29-26(31)23-10-4-8-21-9-5-16-28-25(21)23/h1-3,5-7,9,11-14,16,23-24,27,30H,4,8,10,15,17-18H2,(H,29,31) |
| InChIKey | TVXPLAKOVFMZLB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|