C31H40N6O4 — CID 18336438
dimethyl 5-[3-[[3-(6-tert-butyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-4-methylanilino]benzene-1,3-dicarboxylate (PubChem CID 18336438) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is dimethyl 5-[3-[[3-(6-tert-butyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-4-methylanilino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[[3-(6-tert-butyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-4-methylanilino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18336438 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | dimethyl 5-[3-[[3-(6-tert-butyl-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-4-methylanilino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ccc(C)c(NC(C)(C)C(C)(C)c3nnc4cc(C(C)(C)C)[nH]n34)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C31H40N6O4/c1-18-11-12-21(32-22-14-19(26(38)40-9)13-20(15-22)27(39)41-10)16-23(18)33-31(7,8)30(5,6)28-35-34-25-17-24(29(2,3)4)36-37(25)28/h11-17,32-33,36H,1-10H3 |
| InChIKey | AZRNKPQTZHUNSW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |