(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate

C12H21N3O4 — CID 18339260

IUPAC(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate
SMILESCNCCCCC(NC)C(=O)ON1C(=O)CCC1=O
InChIInChI=1S/C12H21N3O4/c1-13-8-4-3-5-9(14-2)12(18)19-15-10(16)6-7-11(15)17/h9,13-14H,3-8H2,1-2H3
InChIKeyXMZUBGOCCLYGBB-UHFFFAOYSA-N
MW271.32 g/mol
LogP-0.43
Rot. Bonds8

About (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate

(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate (PubChem CID 18339260) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate.

Molecular Properties

Compound Name(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate
PubChem CID18339260
Molecular FormulaC12H21N3O4
Molecular Weight271.32 g/mol
Exact Mass271.15
IUPAC Name(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate
SMILESCNCCCCC(NC)C(=O)ON1C(=O)CCC1=O
InChIInChI=1S/C12H21N3O4/c1-13-8-4-3-5-9(14-2)12(18)19-15-10(16)6-7-11(15)17/h9,13-14H,3-8H2,1-2H3
InChIKeyXMZUBGOCCLYGBB-UHFFFAOYSA-N
XLogP-0.43
TPSA87.74 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.32
LogP ≤ 5-0.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate (CID 18339260) is (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate is CNCCCCC(NC)C(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate?
The InChIKey is XMZUBGOCCLYGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O4/c1-13-8-4-3-5-9(14-2)12(18)19-15-10(16)6-7-11(15)17/h9,13-14H,3-8H2,1-2H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate?
(2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate has a molecular weight of 271.32 g/mol, XLogP of -0.43, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2,6-bis(methylamino)hexanoate is sourced from PubChem (CID 18339260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).