C37H46N2O11S — CID 18353205
2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;N-ethyl-1-(4-methoxyphenyl)-N-[methylsulfonyl(piperidin-4-yl)methyl]propan-2-amine (PubChem CID 18353205) has the molecular formula C37H46N2O11S and a molecular weight of 726.85 g/mol. Its IUPAC name is 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;N-ethyl-1-(4-methoxyphenyl)-N-[methylsulfonyl(piperidin-4-yl)methyl]propan-2-amine.
| Compound Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;N-ethyl-1-(4-methoxyphenyl)-N-[methylsulfonyl(piperidin-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 18353205 |
| Molecular Formula | C37H46N2O11S |
| Molecular Weight | 726.85 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;N-ethyl-1-(4-methoxyphenyl)-N-[methylsulfonyl(piperidin-4-yl)methyl]propan-2-amine |
| SMILES | CCN(C(C)Cc1ccc(OC)cc1)C(C1CCNCC1)S(C)(=O)=O.O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H32N2O3S.C18H14O8/c1-5-21(15(2)14-16-6-8-18(24-3)9-7-16)19(25(4,22)23)17-10-12-20-13-11-17;19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12/h6-9,15,17,19-20H,5,10-14H2,1-4H3;1-10,25-26H,(H,21,22)(H,23,24) |
| InChIKey | VORIPHHHZBGYLP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 207.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|