C38H38N6O7S — CID 18366646
2-[5-[(benzylsulfamoylamino)methyl]-6-oxo-2-phenylpyrimidin-1-yl]-N-(3,4-dioxo-1-phenyl-7-pyridin-2-yloxyheptan-2-yl)acetamide (PubChem CID 18366646) has the molecular formula C38H38N6O7S and a molecular weight of 722.82 g/mol. Its IUPAC name is 2-[5-[(benzylsulfamoylamino)methyl]-6-oxo-2-phenylpyrimidin-1-yl]-N-(3,4-dioxo-1-phenyl-7-pyridin-2-yloxyheptan-2-yl)acetamide.
| Compound Name | 2-[5-[(benzylsulfamoylamino)methyl]-6-oxo-2-phenylpyrimidin-1-yl]-N-(3,4-dioxo-1-phenyl-7-pyridin-2-yloxyheptan-2-yl)acetamide |
|---|---|
| PubChem CID | 18366646 |
| Molecular Formula | C38H38N6O7S |
| Molecular Weight | 722.82 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | 2-[5-[(benzylsulfamoylamino)methyl]-6-oxo-2-phenylpyrimidin-1-yl]-N-(3,4-dioxo-1-phenyl-7-pyridin-2-yloxyheptan-2-yl)acetamide |
| SMILES | O=C(Cn1c(-c2ccccc2)ncc(CNS(=O)(=O)NCc2ccccc2)c1=O)NC(Cc1ccccc1)C(=O)C(=O)CCCOc1ccccn1 |
| InChI | InChI=1S/C38H38N6O7S/c45-33(19-12-22-51-35-20-10-11-21-39-35)36(47)32(23-28-13-4-1-5-14-28)43-34(46)27-44-37(30-17-8-3-9-18-30)40-25-31(38(44)48)26-42-52(49,50)41-24-29-15-6-2-7-16-29/h1-11,13-18,20-21,25,32,41-42H,12,19,22-24,26-27H2,(H,43,46) |
| InChIKey | SEQCUDVSPWKBAH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 178.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|