C42H41NO2SSi — CID 18367432
tert-butyl-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)thiolan-3-yl]methyl]phenoxy]-diphenylsilane (PubChem CID 18367432) has the molecular formula C42H41NO2SSi and a molecular weight of 651.95 g/mol. Its IUPAC name is tert-butyl-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)thiolan-3-yl]methyl]phenoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)thiolan-3-yl]methyl]phenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 18367432 |
| Molecular Formula | C42H41NO2SSi |
| Molecular Weight | 651.95 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | tert-butyl-[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)thiolan-3-yl]methyl]phenoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1cccc(CC2CCSC2c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H41NO2SSi/c1-42(2,3)47(36-23-12-6-13-24-36,37-25-14-7-15-26-37)45-35-22-16-17-31(30-35)29-34-27-28-46-40(34)41-43-38(32-18-8-4-9-19-32)39(44-41)33-20-10-5-11-21-33/h4-26,30,34,40H,27-29H2,1-3H3 |
| InChIKey | YFAOXJSHGWODRD-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.95 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|