C8H4N4O4S2 — CID 18374307
3-pyridin-2-yl-5,6-disulfonyl-1,2,4-triazine (PubChem CID 18374307) has the molecular formula C8H4N4O4S2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-pyridin-2-yl-5,6-disulfonyl-1,2,4-triazine.
| Compound Name | 3-pyridin-2-yl-5,6-disulfonyl-1,2,4-triazine |
|---|---|
| PubChem CID | 18374307 |
| Molecular Formula | C8H4N4O4S2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 3-pyridin-2-yl-5,6-disulfonyl-1,2,4-triazine |
| SMILES | O=S(=O)=C1N=NC(c2ccccn2)=NC1=S(=O)=O |
| InChI | InChI=1S/C8H4N4O4S2/c13-17(14)7-8(18(15)16)12-11-6(10-7)5-3-1-2-4-9-5/h1-4H |
| InChIKey | PUNHSYICYPCIKD-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 118.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|