C23H31ClN2O2 — CID 18381572
2-(1-adamantyl)-N-(2-chloro-5-piperidin-4-yloxyphenyl)acetamide (PubChem CID 18381572) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2-chloro-5-piperidin-4-yloxyphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2-chloro-5-piperidin-4-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 18381572 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(1-adamantyl)-N-(2-chloro-5-piperidin-4-yloxyphenyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1cc(OC2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C23H31ClN2O2/c24-20-2-1-19(28-18-3-5-25-6-4-18)10-21(20)26-22(27)14-23-11-15-7-16(12-23)9-17(8-15)13-23/h1-2,10,15-18,25H,3-9,11-14H2,(H,26,27) |
| InChIKey | LVDQGSJESDCPEN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |