C18H17NO5S — CID 18381751
2-benzamido-2-(2-phenylsulfanylethyl)propanedioic acid (PubChem CID 18381751) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-benzamido-2-(2-phenylsulfanylethyl)propanedioic acid.
| Compound Name | 2-benzamido-2-(2-phenylsulfanylethyl)propanedioic acid |
|---|---|
| PubChem CID | 18381751 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-benzamido-2-(2-phenylsulfanylethyl)propanedioic acid |
| SMILES | O=C(NC(CCSc1ccccc1)(C(=O)O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO5S/c20-15(13-7-3-1-4-8-13)19-18(16(21)22,17(23)24)11-12-25-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | UORXLMMUOXVJDV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|