C5H12N4O5S — CID 18387090
1-hydroxyethyl hydrogen sulfate;1H-pyrazole-4,5-diamine (PubChem CID 18387090) has the molecular formula C5H12N4O5S and a molecular weight of 240.24 g/mol. Its IUPAC name is 1-hydroxyethyl hydrogen sulfate;1H-pyrazole-4,5-diamine.
| Compound Name | 1-hydroxyethyl hydrogen sulfate;1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 18387090 |
| Molecular Formula | C5H12N4O5S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-hydroxyethyl hydrogen sulfate;1H-pyrazole-4,5-diamine |
| SMILES | CC(O)OS(=O)(=O)O.Nc1cn[nH]c1N |
| InChI | InChI=1S/C3H6N4.C2H6O5S/c4-2-1-6-7-3(2)5;1-2(3)7-8(4,5)6/h1H,4H2,(H3,5,6,7);2-3H,1H3,(H,4,5,6) |
| InChIKey | RVJIDVDFQPUIJR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|