C23H25N2O9PS — CID 18394890
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-[[3-(4-methylphenoxy)phenyl]methyl]-2-oxo-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 18394890) has the molecular formula C23H25N2O9PS and a molecular weight of 536.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-[[3-(4-methylphenoxy)phenyl]methyl]-2-oxo-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-[[3-(4-methylphenoxy)phenyl]methyl]-2-oxo-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 18394890 |
| Molecular Formula | C23H25N2O9PS |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-[[3-(4-methylphenoxy)phenyl]methyl]-2-oxo-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1ccc(Oc2cccc(Cc3cn([C@@H]4O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]4O)c(=O)[nH]c3=S)c2)cc1 |
| InChI | InChI=1S/C23H25N2O9PS/c1-13-5-7-16(8-6-13)33-17-4-2-3-14(10-17)9-15-11-25(23(28)24-21(15)36)22-20(27)19(26)18(34-22)12-32-35(29,30)31/h2-8,10-11,18-20,22,26-27H,9,12H2,1H3,(H,24,28,36)(H2,29,30,31)/t18-,19-,20-,22-/m1/s1 |
| InChIKey | FTZFJYWXIAPKGO-NXLVEIQXSA-N |
| XLogP | 2.33 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|