C23H27N2O15P3S — CID 54131314
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-5-[(4-phenoxyphenyl)methyl]-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] methyl phosphate (PubChem CID 54131314) has the molecular formula C23H27N2O15P3S and a molecular weight of 696.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-5-[(4-phenoxyphenyl)methyl]-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] methyl phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-5-[(4-phenoxyphenyl)methyl]-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] methyl phosphate |
|---|---|
| PubChem CID | 54131314 |
| Molecular Formula | C23H27N2O15P3S |
| Molecular Weight | 696.46 g/mol |
| Exact Mass | 696.03 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-5-[(4-phenoxyphenyl)methyl]-4-sulfanylidenepyrimidin-1-yl]oxolan-2-yl]methyl [hydroxy(phosphonooxy)phosphoryl] methyl phosphate |
| SMILES | COP(=O)(OC[C@H]1O[C@@H](n2cc(Cc3ccc(Oc4ccccc4)cc3)c(=S)[nH]c2=O)[C@H](O)[C@@H]1O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C23H27N2O15P3S/c1-35-43(34,40-42(32,33)39-41(29,30)31)36-13-18-19(26)20(27)22(38-18)25-12-15(21(44)24-23(25)28)11-14-7-9-17(10-8-14)37-16-5-3-2-4-6-16/h2-10,12,18-20,22,26-27H,11,13H2,1H3,(H,32,33)(H,24,28,44)(H2,29,30,31)/t18-,19-,20-,22-,43?/m1/s1 |
| InChIKey | NUOPKCFNVRZZSA-IICBFZHUSA-N |
| XLogP | 2.91 |
| TPSA | 245.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|