C27H26BrFN4O4 — CID 18399996
[2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenyl] 3-(ethylamino)benzoate (PubChem CID 18399996) has the molecular formula C27H26BrFN4O4 and a molecular weight of 569.43 g/mol. Its IUPAC name is [2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenyl] 3-(ethylamino)benzoate.
| Compound Name | [2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenyl] 3-(ethylamino)benzoate |
|---|---|
| PubChem CID | 18399996 |
| Molecular Formula | C27H26BrFN4O4 |
| Molecular Weight | 569.43 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | [2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenyl] 3-(ethylamino)benzoate |
| SMILES | CCNc1cccc(C(=O)Oc2c(C(=O)CC)ccc(F)c2C2CC2NC(=O)Nc2ccc(Br)cn2)c1 |
| InChI | InChI=1S/C27H26BrFN4O4/c1-3-22(34)18-9-10-20(29)24(25(18)37-26(35)15-6-5-7-17(12-15)30-4-2)19-13-21(19)32-27(36)33-23-11-8-16(28)14-31-23/h5-12,14,19,21,30H,3-4,13H2,1-2H3,(H2,31,32,33,36) |
| InChIKey | ZWFZDHXBYBZLSS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|