C26H24BrFN4O4 — CID 54414735
[6-acetyl-2-[(1R,2R)-2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluorophenyl] 3-(dimethylamino)benzoate (PubChem CID 54414735) has the molecular formula C26H24BrFN4O4 and a molecular weight of 555.40 g/mol. Its IUPAC name is [6-acetyl-2-[(1R,2R)-2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluorophenyl] 3-(dimethylamino)benzoate.
| Compound Name | [6-acetyl-2-[(1R,2R)-2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluorophenyl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 54414735 |
| Molecular Formula | C26H24BrFN4O4 |
| Molecular Weight | 555.40 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | [6-acetyl-2-[(1R,2R)-2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluorophenyl] 3-(dimethylamino)benzoate |
| SMILES | CC(=O)c1ccc(F)c([C@H]2C[C@H]2NC(=O)Nc2ccc(Br)cn2)c1OC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C26H24BrFN4O4/c1-14(33)18-8-9-20(28)23(24(18)36-25(34)15-5-4-6-17(11-15)32(2)3)19-12-21(19)30-26(35)31-22-10-7-16(27)13-29-22/h4-11,13,19,21H,12H2,1-3H3,(H2,29,30,31,35)/t19-,21+/m0/s1 |
| InChIKey | VWPMZJJUSDBJLP-PZJWPPBQSA-N |
| XLogP | 5.15 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|