C28H34BrFN4O7 — CID 68769875
3-[2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenoxy]carbonyloxypropyl (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 68769875) has the molecular formula C28H34BrFN4O7 and a molecular weight of 637.50 g/mol. Its IUPAC name is 3-[2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenoxy]carbonyloxypropyl (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | 3-[2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenoxy]carbonyloxypropyl (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 68769875 |
| Molecular Formula | C28H34BrFN4O7 |
| Molecular Weight | 637.50 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 3-[2-[2-[(5-bromo-2-pyridinyl)carbamoylamino]cyclopropyl]-3-fluoro-6-propanoylphenoxy]carbonyloxypropyl (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CCC(=O)c1ccc(F)c(C2CC2NC(=O)Nc2ccc(Br)cn2)c1OC(=O)OCCCOC(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C28H34BrFN4O7/c1-4-15(3)24(31)26(36)39-11-6-12-40-28(38)41-25-17(21(35)5-2)8-9-19(30)23(25)18-13-20(18)33-27(37)34-22-10-7-16(29)14-32-22/h7-10,14-15,18,20,24H,4-6,11-13,31H2,1-3H3,(H2,32,33,34,37)/t15-,18?,20?,24-/m0/s1 |
| InChIKey | KXSPHAOLOBLXBX-UIUHQXJLSA-N |
| XLogP | 5.08 |
| TPSA | 158.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|