C19H19BrFN3O3 — CID 70159547
1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2-methoxy-3-propanoylphenyl)cyclopropyl]urea (PubChem CID 70159547) has the molecular formula C19H19BrFN3O3 and a molecular weight of 436.28 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2-methoxy-3-propanoylphenyl)cyclopropyl]urea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2-methoxy-3-propanoylphenyl)cyclopropyl]urea |
|---|---|
| PubChem CID | 70159547 |
| Molecular Formula | C19H19BrFN3O3 |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(6-fluoro-2-methoxy-3-propanoylphenyl)cyclopropyl]urea |
| SMILES | CCC(=O)c1ccc(F)c(C2CC2NC(=O)Nc2ccc(Br)cn2)c1OC |
| InChI | InChI=1S/C19H19BrFN3O3/c1-3-15(25)11-5-6-13(21)17(18(11)27-2)12-8-14(12)23-19(26)24-16-7-4-10(20)9-22-16/h4-7,9,12,14H,3,8H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | AXZBWQWIANKNTK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |