C29H33N5O3 — CID 18406723
5-tert-butyl-N-methyl-3-[[4-(3-pyridin-4-ylpropoxy)naphthalen-1-yl]carbamoylamino]-1H-pyrrole-2-carboxamide (PubChem CID 18406723) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is 5-tert-butyl-N-methyl-3-[[4-(3-pyridin-4-ylpropoxy)naphthalen-1-yl]carbamoylamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 5-tert-butyl-N-methyl-3-[[4-(3-pyridin-4-ylpropoxy)naphthalen-1-yl]carbamoylamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18406723 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 5-tert-butyl-N-methyl-3-[[4-(3-pyridin-4-ylpropoxy)naphthalen-1-yl]carbamoylamino]-1H-pyrrole-2-carboxamide |
| SMILES | CNC(=O)c1[nH]c(C(C)(C)C)cc1NC(=O)Nc1ccc(OCCCc2ccncc2)c2ccccc12 |
| InChI | InChI=1S/C29H33N5O3/c1-29(2,3)25-18-23(26(34-25)27(35)30-4)33-28(36)32-22-11-12-24(21-10-6-5-9-20(21)22)37-17-7-8-19-13-15-31-16-14-19/h5-6,9-16,18,34H,7-8,17H2,1-4H3,(H,30,35)(H2,32,33,36) |
| InChIKey | KJBQJBYUBRWWFL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|