C15H37NO — CID 18422956
N,N-diethylethanamine;hexane;propan-2-ol (PubChem CID 18422956) has the molecular formula C15H37NO and a molecular weight of 247.47 g/mol. Its IUPAC name is N,N-diethylethanamine;hexane;propan-2-ol.
| Compound Name | N,N-diethylethanamine;hexane;propan-2-ol |
|---|---|
| PubChem CID | 18422956 |
| Molecular Formula | C15H37NO |
| Molecular Weight | 247.47 g/mol |
| Exact Mass | 247.29 |
| IUPAC Name | N,N-diethylethanamine;hexane;propan-2-ol |
| SMILES | CC(C)O.CCCCCC.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C6H14.C3H8O/c1-4-7(5-2)6-3;1-3-5-6-4-2;1-3(2)4/h4-6H2,1-3H3;3-6H2,1-2H3;3-4H,1-2H3 |
| InChIKey | UDUKYWGFJNROKI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|