About benzamido propanoate
benzamido propanoate (PubChem CID 18425256) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is benzamido propanoate.
Molecular Properties
| Compound Name | benzamido propanoate |
| PubChem CID | 18425256 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | benzamido propanoate |
| SMILES | CCC(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-2-9(12)14-11-10(13)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,13) |
| InChIKey | PJNHRDVRPBYAKW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido propanoate?
The IUPAC name of benzamido propanoate (CID 18425256) is benzamido propanoate.
What is the SMILES notation for benzamido propanoate?
The canonical SMILES for benzamido propanoate is CCC(=O)ONC(=O)c1ccccc1.
What is the InChIKey of benzamido propanoate?
The InChIKey is PJNHRDVRPBYAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-2-9(12)14-11-10(13)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,13).
What are the key properties of benzamido propanoate?
benzamido propanoate has a molecular weight of 193.20 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido propanoate is sourced from PubChem (CID 18425256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).