C5H11N3 — CID 18428540
2,3,4,5-tetrahydropyridine-4,6-diamine (PubChem CID 18428540) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 2,3,4,5-tetrahydropyridine-4,6-diamine.
| Compound Name | 2,3,4,5-tetrahydropyridine-4,6-diamine |
|---|---|
| PubChem CID | 18428540 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 2,3,4,5-tetrahydropyridine-4,6-diamine |
| SMILES | NC1=NCCC(N)C1 |
| InChI | InChI=1S/C5H11N3/c6-4-1-2-8-5(7)3-4/h4H,1-3,6H2,(H2,7,8) |
| InChIKey | YZUPVLLZUJMVPP-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |