C8H12NS+ — CID 18432209
4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 18432209) has the molecular formula C8H12NS+ and a molecular weight of 154.26 g/mol. Its IUPAC name is 4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | 4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 18432209 |
| Molecular Formula | C8H12NS+ |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 4,5-dimethyl-3-prop-2-ynyl-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | C#CC[N+]1=CSC(C)C1C |
| InChI | InChI=1S/C8H12NS/c1-4-5-9-6-10-8(3)7(9)2/h1,6-8H,5H2,2-3H3/q+1 |
| InChIKey | SXJAEDKYHBUCLM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|