C24H29N3O8S5 — CID 18434011
4-imino-1-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butane-2-sulfonic acid (PubChem CID 18434011) has the molecular formula C24H29N3O8S5 and a molecular weight of 647.84 g/mol. Its IUPAC name is 4-imino-1-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butane-2-sulfonic acid.
| Compound Name | 4-imino-1-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 18434011 |
| Molecular Formula | C24H29N3O8S5 |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.06 |
| IUPAC Name | 4-imino-1-oxo-1,4-bis[4-(pyridin-2-yldisulfanyl)pentanoyloxy]butane-2-sulfonic acid |
| SMILES | [H]/N=C(/CC(C(=O)OC(=O)CCC(C)SSc1ccccn1)S(=O)(=O)O)OC(=O)CCC(C)SSc1ccccn1 |
| InChI | InChI=1S/C24H29N3O8S5/c1-16(36-38-20-7-3-5-13-26-20)9-11-22(28)34-19(25)15-18(40(31,32)33)24(30)35-23(29)12-10-17(2)37-39-21-8-4-6-14-27-21/h3-8,13-14,16-18,25H,9-12,15H2,1-2H3,(H,31,32,33)/b25-19- |
| InChIKey | SJOMXAZAFGSNGI-PLRJNAJWSA-N |
| XLogP | 5.23 |
| TPSA | 173.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|