C27H31N5OS — CID 18440768
1-[2-[4-(6-methoxynaphthalen-2-yl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropyl]-1-propylthiourea (PubChem CID 18440768) has the molecular formula C27H31N5OS and a molecular weight of 473.65 g/mol. Its IUPAC name is 1-[2-[4-(6-methoxynaphthalen-2-yl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropyl]-1-propylthiourea.
| Compound Name | 1-[2-[4-(6-methoxynaphthalen-2-yl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropyl]-1-propylthiourea |
|---|---|
| PubChem CID | 18440768 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 1-[2-[4-(6-methoxynaphthalen-2-yl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2-methylpropyl]-1-propylthiourea |
| SMILES | CCCN(CC(C)(C)c1nc(-c2ccc3cc(OC)ccc3c2)c(-c2ccncc2)[nH]1)C(N)=S |
| InChI | InChI=1S/C27H31N5OS/c1-5-14-32(26(28)34)17-27(2,3)25-30-23(18-10-12-29-13-11-18)24(31-25)21-7-6-20-16-22(33-4)9-8-19(20)15-21/h6-13,15-16H,5,14,17H2,1-4H3,(H2,28,34)(H,30,31) |
| InChIKey | SMVOCUHLAQYJPX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|