C13H12ClN5O6 — CID 18452872
2-[(2-chloro-5-nitro-2H-pyrimidin-5-yl)amino]-3-(4-nitrophenyl)propanoic acid (PubChem CID 18452872) has the molecular formula C13H12ClN5O6 and a molecular weight of 369.72 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitro-2H-pyrimidin-5-yl)amino]-3-(4-nitrophenyl)propanoic acid.
| Compound Name | 2-[(2-chloro-5-nitro-2H-pyrimidin-5-yl)amino]-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 18452872 |
| Molecular Formula | C13H12ClN5O6 |
| Molecular Weight | 369.72 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-[(2-chloro-5-nitro-2H-pyrimidin-5-yl)amino]-3-(4-nitrophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc([N+](=O)[O-])cc1)NC1([N+](=O)[O-])C=NC(Cl)N=C1 |
| InChI | InChI=1S/C13H12ClN5O6/c14-12-15-6-13(7-16-12,19(24)25)17-10(11(20)21)5-8-1-3-9(4-2-8)18(22)23/h1-4,6-7,10,12,17H,5H2,(H,20,21) |
| InChIKey | ARSDJQIOUBLCKT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 160.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.72 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|