About CID 18454148
CID 18454148 (PubChem CID 18454148) has the molecular formula C31H39O6Si4
and a molecular weight of 619.99 g/mol.
Molecular Properties
| Compound Name | CID 18454148 |
| PubChem CID | 18454148 |
| Molecular Formula | C31H39O6Si4 |
| Molecular Weight | 619.99 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | — |
| SMILES | COc1cccc([Si]C(C)C([Si])(C(C)[Si]c2cccc(OC)c2OC)C(C)[Si]c2cccc(OC)c2OC)c1OC |
| InChI | InChI=1S/C31H39O6Si4/c1-19(39-25-16-10-13-22(32-4)28(25)35-7)31(38,20(2)40-26-17-11-14-23(33-5)29(26)36-8)21(3)41-27-18-12-15-24(34-6)30(27)37-9/h10-21H,1-9H3 |
| InChIKey | OBTNVLFGPLFLKJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 619.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18454148 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18454148?
The IUPAC name of CID 18454148 (CID 18454148) is not available.
What is the SMILES notation for CID 18454148?
The canonical SMILES for CID 18454148 is COc1cccc([Si]C(C)C([Si])(C(C)[Si]c2cccc(OC)c2OC)C(C)[Si]c2cccc(OC)c2OC)c1OC.
What is the InChIKey of CID 18454148?
The InChIKey is OBTNVLFGPLFLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H39O6Si4/c1-19(39-25-16-10-13-22(32-4)28(25)35-7)31(38,20(2)40-26-17-11-14-23(33-5)29(26)36-8)21(3)41-27-18-12-15-24(34-6)30(27)37-9/h10-21H,1-9H3.
What are the key properties of CID 18454148?
CID 18454148 has a molecular weight of 619.99 g/mol, XLogP of 3.88, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18454148 is sourced from PubChem (CID 18454148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).