C6H9N3O — CID 18459141
N,N-dimethyl-1H-pyrazole-5-carboxamide (PubChem CID 18459141) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is N,N-dimethyl-1H-pyrazole-5-carboxamide.
| Compound Name | N,N-dimethyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 18459141 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | N,N-dimethyl-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C6H9N3O/c1-9(2)6(10)5-3-4-7-8-5/h3-4H,1-2H3,(H,7,8) |
| InChIKey | WNWABQGHVAKUDZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |