C30H35N3O5 — CID 18464342
N'-[1-(4-hydroxy-2,5-dimethylanilino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-methylpentanediamide (PubChem CID 18464342) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is N'-[1-(4-hydroxy-2,5-dimethylanilino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-methylpentanediamide.
| Compound Name | N'-[1-(4-hydroxy-2,5-dimethylanilino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-methylpentanediamide |
|---|---|
| PubChem CID | 18464342 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N'-[1-(4-hydroxy-2,5-dimethylanilino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-2-methylpentanediamide |
| SMILES | Cc1cc(NC(=O)C(Cc2ccc(OCc3ccccc3)cc2)NC(=O)CCC(C)C(N)=O)c(C)cc1O |
| InChI | InChI=1S/C30H35N3O5/c1-19(29(31)36)9-14-28(35)32-26(30(37)33-25-15-21(3)27(34)16-20(25)2)17-22-10-12-24(13-11-22)38-18-23-7-5-4-6-8-23/h4-8,10-13,15-16,19,26,34H,9,14,17-18H2,1-3H3,(H2,31,36)(H,32,35)(H,33,37) |
| InChIKey | VSOHWQQCOQXOGN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|