C29H33N5 — CID 18475942
3-[4-[4-[(2,6-dimethylpiperidin-1-yl)methyl]phenyl]-3H-quinoxalin-2-yl]benzenecarboximidamide (PubChem CID 18475942) has the molecular formula C29H33N5 and a molecular weight of 451.62 g/mol. Its IUPAC name is 3-[4-[4-[(2,6-dimethylpiperidin-1-yl)methyl]phenyl]-3H-quinoxalin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[4-[4-[(2,6-dimethylpiperidin-1-yl)methyl]phenyl]-3H-quinoxalin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18475942 |
| Molecular Formula | C29H33N5 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 3-[4-[4-[(2,6-dimethylpiperidin-1-yl)methyl]phenyl]-3H-quinoxalin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=Nc3ccccc3N(c3ccc(CN4C(C)CCCC4C)cc3)C2)c1 |
| InChI | InChI=1S/C29H33N5/c1-20-7-5-8-21(2)33(20)18-22-13-15-25(16-14-22)34-19-27(32-26-11-3-4-12-28(26)34)23-9-6-10-24(17-23)29(30)31/h3-4,6,9-17,20-21H,5,7-8,18-19H2,1-2H3,(H3,30,31) |
| InChIKey | NQOFVVLMCKRCAB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|