C28H40N10O5S — CID 18493286
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18493286) has the molecular formula C28H40N10O5S and a molecular weight of 628.76 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18493286 |
| Molecular Formula | C28H40N10O5S |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H40N10O5S/c1-44-10-8-22(26(41)38-23(27(42)43)11-16-13-34-20-6-3-2-5-18(16)20)37-25(40)21(7-4-9-33-28(30)31)36-24(39)19(29)12-17-14-32-15-35-17/h2-3,5-6,13-15,19,21-23,34H,4,7-12,29H2,1H3,(H,32,35)(H,36,39)(H,37,40)(H,38,41)(H,42,43)(H4,30,31,33) |
| InChIKey | VQAFRYBKCQBPQR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 259.49 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|