About diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium
diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium (PubChem CID 18503261) has the molecular formula C34H31P2Ru+
and a molecular weight of 602.64 g/mol. Its IUPAC name is diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium.
Molecular Properties
| Compound Name | diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium |
| PubChem CID | 18503261 |
| Molecular Formula | C34H31P2Ru+ |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium |
| SMILES | [Ru].c1cc2cc[cH-]cc-2c1.c1ccc([PH+](C[PH+](c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P2.C9H7.Ru/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-2-5-9-7-3-6-8(9)4-1;/h1-20H,21H2;1-7H;/q;-1;/p+2 |
| InChIKey | XBQMOEBPPURHID-UHFFFAOYSA-P |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium?
The IUPAC name of diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium (CID 18503261) is diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium.
What is the SMILES notation for diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium?
The canonical SMILES for diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium is [Ru].c1cc2cc[cH-]cc-2c1.c1ccc([PH+](C[PH+](c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium?
The InChIKey is XBQMOEBPPURHID-UHFFFAOYSA-P. The full InChI is InChI=1S/C25H22P2.C9H7.Ru/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-2-5-9-7-3-6-8(9)4-1;/h1-20H,21H2;1-7H;/q;-1;/p+2.
What are the key properties of diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium?
diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium has a molecular weight of 602.64 g/mol, XLogP of 7.18, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphaniumylmethyl(diphenyl)phosphanium;5H-inden-5-ide;ruthenium is sourced from PubChem (CID 18503261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).