C22H11Br2F6O3P — CID 18515048
[2,6-bis(trifluoromethyl)phenyl]-[(2,6-dibromobenzoyl)-phenylphosphoryl]methanone (PubChem CID 18515048) has the molecular formula C22H11Br2F6O3P and a molecular weight of 628.10 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-[(2,6-dibromobenzoyl)-phenylphosphoryl]methanone.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-[(2,6-dibromobenzoyl)-phenylphosphoryl]methanone |
|---|---|
| PubChem CID | 18515048 |
| Molecular Formula | C22H11Br2F6O3P |
| Molecular Weight | 628.10 g/mol |
| Exact Mass | 625.87 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-[(2,6-dibromobenzoyl)-phenylphosphoryl]methanone |
| SMILES | O=C(c1c(Br)cccc1Br)P(=O)(C(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H11Br2F6O3P/c23-15-10-5-11-16(24)18(15)20(32)34(33,12-6-2-1-3-7-12)19(31)17-13(21(25,26)27)8-4-9-14(17)22(28,29)30/h1-11H |
| InChIKey | DMRWYCDLSFVLGZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.10 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|