C23H28N2O3 — CID 18528134
ethyl (Z)-3-[4-(diethylamino)phenyl]-2-[(4-methylbenzoyl)amino]prop-2-enoate (PubChem CID 18528134) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl (Z)-3-[4-(diethylamino)phenyl]-2-[(4-methylbenzoyl)amino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-(diethylamino)phenyl]-2-[(4-methylbenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 18528134 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | ethyl (Z)-3-[4-(diethylamino)phenyl]-2-[(4-methylbenzoyl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccc(N(CC)CC)cc1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-25(6-2)20-14-10-18(11-15-20)16-21(23(27)28-7-3)24-22(26)19-12-8-17(4)9-13-19/h8-16H,5-7H2,1-4H3,(H,24,26)/b21-16- |
| InChIKey | BKEGJVPHIWFJJU-PGMHBOJBSA-N |
| XLogP | 4.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|