C16H14ClN3O4 — CID 18536749
ethyl 7-chloro-6-[4-(hydroxymethyl)imidazol-1-yl]-2-oxo-1H-quinoline-3-carboxylate (PubChem CID 18536749) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is ethyl 7-chloro-6-[4-(hydroxymethyl)imidazol-1-yl]-2-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 7-chloro-6-[4-(hydroxymethyl)imidazol-1-yl]-2-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 18536749 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | ethyl 7-chloro-6-[4-(hydroxymethyl)imidazol-1-yl]-2-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(-n3cnc(CO)c3)c(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C16H14ClN3O4/c1-2-24-16(23)11-3-9-4-14(20-6-10(7-21)18-8-20)12(17)5-13(9)19-15(11)22/h3-6,8,21H,2,7H2,1H3,(H,19,22) |
| InChIKey | MYAGDTIWMFOTME-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |