C13H31NO2Si — CID 18538179
4-[diethoxy(methyl)silyl]-2,2-diethylbutan-1-amine (PubChem CID 18538179) has the molecular formula C13H31NO2Si and a molecular weight of 261.48 g/mol. Its IUPAC name is 4-[diethoxy(methyl)silyl]-2,2-diethylbutan-1-amine.
| Compound Name | 4-[diethoxy(methyl)silyl]-2,2-diethylbutan-1-amine |
|---|---|
| PubChem CID | 18538179 |
| Molecular Formula | C13H31NO2Si |
| Molecular Weight | 261.48 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-[diethoxy(methyl)silyl]-2,2-diethylbutan-1-amine |
| SMILES | CCO[Si](C)(CCC(CC)(CC)CN)OCC |
| InChI | InChI=1S/C13H31NO2Si/c1-6-13(7-2,12-14)10-11-17(5,15-8-3)16-9-4/h6-12,14H2,1-5H3 |
| InChIKey | CJIBCOAIAHBDEL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|