C38H84O11S3Si3 — CID 59408010
3-[1-[2,2-bis[1-(3-triethoxysilylpropylsulfanyl)ethoxymethyl]butoxy]ethylsulfanyl]propyl-diethoxy-methylsilane (PubChem CID 59408010) has the molecular formula C38H84O11S3Si3 and a molecular weight of 897.54 g/mol. Its IUPAC name is 3-[1-[2,2-bis[1-(3-triethoxysilylpropylsulfanyl)ethoxymethyl]butoxy]ethylsulfanyl]propyl-diethoxy-methylsilane.
| Compound Name | 3-[1-[2,2-bis[1-(3-triethoxysilylpropylsulfanyl)ethoxymethyl]butoxy]ethylsulfanyl]propyl-diethoxy-methylsilane |
|---|---|
| PubChem CID | 59408010 |
| Molecular Formula | C38H84O11S3Si3 |
| Molecular Weight | 897.54 g/mol |
| Exact Mass | 896.45 |
| IUPAC Name | 3-[1-[2,2-bis[1-(3-triethoxysilylpropylsulfanyl)ethoxymethyl]butoxy]ethylsulfanyl]propyl-diethoxy-methylsilane |
| SMILES | CCO[Si](C)(CCCSC(C)OCC(CC)(COC(C)SCCC[Si](OCC)(OCC)OCC)COC(C)SCCC[Si](OCC)(OCC)OCC)OCC |
| InChI | InChI=1S/C38H84O11S3Si3/c1-14-38(32-39-35(10)50-26-23-29-53(13,42-15-2)43-16-3,33-40-36(11)51-27-24-30-54(44-17-4,45-18-5)46-19-6)34-41-37(12)52-28-25-31-55(47-20-7,48-21-8)49-22-9/h35-37H,14-34H2,1-13H3 |
| InChIKey | VYKZUTNTGSIHCY-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.54 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|