C19H23F3N2 — CID 18555364
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 18555364) has the molecular formula C19H23F3N2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 18555364 |
| Molecular Formula | C19H23F3N2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(C[C@H]3C[C@H]4C=C[C@H]3C4)CC2)c1 |
| InChI | InChI=1S/C19H23F3N2/c20-19(21,22)17-2-1-3-18(12-17)24-8-6-23(7-9-24)13-16-11-14-4-5-15(16)10-14/h1-5,12,14-16H,6-11,13H2/t14-,15-,16+/m0/s1 |
| InChIKey | FIAOAIAXJRLEKI-HRCADAONSA-N |
| XLogP | 4.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|