C20H16ClN2O4S- — CID 18555858
(1R,2S,3R,4R)-3-[[4-chloro-3-(thiophene-2-carbonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18555858) has the molecular formula C20H16ClN2O4S- and a molecular weight of 415.88 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[4-chloro-3-(thiophene-2-carbonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4R)-3-[[4-chloro-3-(thiophene-2-carbonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18555858 |
| Molecular Formula | C20H16ClN2O4S- |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[4-chloro-3-(thiophene-2-carbonylamino)phenyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Nc1cc(NC(=O)[C@H]2[C@@H](C(=O)[O-])[C@H]3C=C[C@H]2C3)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C20H17ClN2O4S/c21-13-6-5-12(9-14(13)23-18(24)15-2-1-7-28-15)22-19(25)16-10-3-4-11(8-10)17(16)20(26)27/h1-7,9-11,16-17H,8H2,(H,22,25)(H,23,24)(H,26,27)/p-1/t10-,11-,16+,17-/m0/s1 |
| InChIKey | DMZKZVOMYNYIME-ZAGRPGIDSA-M |
| XLogP | 2.78 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|