C20H21N5O2S2 — CID 18560188
10-(4-methylphenyl)sulfonyl-7-(3-methylpiperidin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 18560188) has the molecular formula C20H21N5O2S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 10-(4-methylphenyl)sulfonyl-7-(3-methylpiperidin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(4-methylphenyl)sulfonyl-7-(3-methylpiperidin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 18560188 |
| Molecular Formula | C20H21N5O2S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 10-(4-methylphenyl)sulfonyl-7-(3-methylpiperidin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)c2nnn3c2nc(N2CCCC(C)C2)c2sccc23)cc1 |
| InChI | InChI=1S/C20H21N5O2S2/c1-13-5-7-15(8-6-13)29(26,27)20-19-21-18(24-10-3-4-14(2)12-24)17-16(9-11-28-17)25(19)23-22-20/h5-9,11,14H,3-4,10,12H2,1-2H3 |
| InChIKey | DUPBRWKEUUFCSU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |