C21H24N6O2S2 — CID 20901221
10-(2,5-dimethylphenyl)sulfonyl-7-(4-ethylpiperazin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 20901221) has the molecular formula C21H24N6O2S2 and a molecular weight of 456.60 g/mol. Its IUPAC name is 10-(2,5-dimethylphenyl)sulfonyl-7-(4-ethylpiperazin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(2,5-dimethylphenyl)sulfonyl-7-(4-ethylpiperazin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 20901221 |
| Molecular Formula | C21H24N6O2S2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 10-(2,5-dimethylphenyl)sulfonyl-7-(4-ethylpiperazin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CCN1CCN(c2nc3c(S(=O)(=O)c4cc(C)ccc4C)nnn3c3ccsc23)CC1 |
| InChI | InChI=1S/C21H24N6O2S2/c1-4-25-8-10-26(11-9-25)19-18-16(7-12-30-18)27-20(22-19)21(23-24-27)31(28,29)17-13-14(2)5-6-15(17)3/h5-7,12-13H,4,8-11H2,1-3H3 |
| InChIKey | UJPHGYFUHXYTPK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |