C17H14ClN5O3S2 — CID 71518213
4-[10-(2-chlorophenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-yl]morpholine (PubChem CID 71518213) has the molecular formula C17H14ClN5O3S2 and a molecular weight of 435.92 g/mol. Its IUPAC name is 4-[10-(2-chlorophenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-yl]morpholine.
| Compound Name | 4-[10-(2-chlorophenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-yl]morpholine |
|---|---|
| PubChem CID | 71518213 |
| Molecular Formula | C17H14ClN5O3S2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 4-[10-(2-chlorophenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-7-yl]morpholine |
| SMILES | O=S(=O)(c1ccccc1Cl)c1nnn2c1nc(N1CCOCC1)c1sccc12 |
| InChI | InChI=1S/C17H14ClN5O3S2/c18-11-3-1-2-4-13(11)28(24,25)17-16-19-15(22-6-8-26-9-7-22)14-12(5-10-27-14)23(16)21-20-17/h1-5,10H,6-9H2 |
| InChIKey | DSEXOPSFWWIFLS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |