C24H18ClN5O2S2 — CID 71821142
10-(4-chlorophenyl)sulfonyl-7-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 71821142) has the molecular formula C24H18ClN5O2S2 and a molecular weight of 508.03 g/mol. Its IUPAC name is 10-(4-chlorophenyl)sulfonyl-7-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(4-chlorophenyl)sulfonyl-7-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 71821142 |
| Molecular Formula | C24H18ClN5O2S2 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 10-(4-chlorophenyl)sulfonyl-7-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1nnn2c1nc(N1CC=C(c3ccccc3)CC1)c1sccc12 |
| InChI | InChI=1S/C24H18ClN5O2S2/c25-18-6-8-19(9-7-18)34(31,32)24-23-26-22(21-20(12-15-33-21)30(23)28-27-24)29-13-10-17(11-14-29)16-4-2-1-3-5-16/h1-10,12,15H,11,13-14H2 |
| InChIKey | MNATVEBCYZDPQQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |