C14H21NO4S2 — CID 18573650
N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 18573650) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18573650 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-12(2)10-15(13-8-9-20(16,17)11-13)21(18,19)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | MJXLXXTTWUGVBJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |