About 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride
4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride (PubChem CID 18576899) has the molecular formula C14H18ClN3OS
and a molecular weight of 311.84 g/mol. Its IUPAC name is 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride |
| PubChem CID | 18576899 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride |
| SMILES | Cc1cs/c(=N\c2ccccc2)n1N1CCOCC1.Cl |
| InChI | InChI=1S/C14H17N3OS.ClH/c1-12-11-19-14(15-13-5-3-2-4-6-13)17(12)16-7-9-18-10-8-16;/h2-6,11H,7-10H2,1H3;1H/b15-14-; |
| InChIKey | CCVOTPWTCQYEAP-BGWNKZQTSA-N |
| XLogP | 2.48 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride?
The IUPAC name of 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride (CID 18576899) is 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride.
What is the SMILES notation for 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride?
The canonical SMILES for 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride is Cc1cs/c(=N\c2ccccc2)n1N1CCOCC1.Cl.
What is the InChIKey of 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride?
The InChIKey is CCVOTPWTCQYEAP-BGWNKZQTSA-N. The full InChI is InChI=1S/C14H17N3OS.ClH/c1-12-11-19-14(15-13-5-3-2-4-6-13)17(12)16-7-9-18-10-8-16;/h2-6,11H,7-10H2,1H3;1H/b15-14-;.
What are the key properties of 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride?
4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride has a molecular weight of 311.84 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-morpholin-4-yl-N-phenyl-1,3-thiazol-2-imine;hydrochloride is sourced from PubChem (CID 18576899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).