C29H29N5S2 — CID 18590484
[4-(dimethylamino)phenyl]-[4-(1,3-diphenylpyrazole-4-carbothioyl)piperazin-1-yl]methanethione (PubChem CID 18590484) has the molecular formula C29H29N5S2 and a molecular weight of 511.72 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-[4-(1,3-diphenylpyrazole-4-carbothioyl)piperazin-1-yl]methanethione.
| Compound Name | [4-(dimethylamino)phenyl]-[4-(1,3-diphenylpyrazole-4-carbothioyl)piperazin-1-yl]methanethione |
|---|---|
| PubChem CID | 18590484 |
| Molecular Formula | C29H29N5S2 |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | [4-(dimethylamino)phenyl]-[4-(1,3-diphenylpyrazole-4-carbothioyl)piperazin-1-yl]methanethione |
| SMILES | CN(C)c1ccc(C(=S)N2CCN(C(=S)c3cn(-c4ccccc4)nc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H29N5S2/c1-31(2)24-15-13-23(14-16-24)28(35)32-17-19-33(20-18-32)29(36)26-21-34(25-11-7-4-8-12-25)30-27(26)22-9-5-3-6-10-22/h3-16,21H,17-20H2,1-2H3 |
| InChIKey | MQJMCMKWTUEEND-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|