C28H46O4Si — CID 18598034
(5E)-5-[(3aS,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoic acid (PubChem CID 18598034) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (5E)-5-[(3aS,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoic acid.
| Compound Name | (5E)-5-[(3aS,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoic acid |
|---|---|
| PubChem CID | 18598034 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (5E)-5-[(3aS,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/[C@H]1CC[C@H]2C/C(=C\CCC(=O)C(=O)O)C[C@@H]21)C1CCCCC1 |
| InChI | InChI=1S/C28H46O4Si/c1-28(2,3)33(4,5)32-26(22-11-7-6-8-12-22)17-16-21-14-15-23-18-20(19-24(21)23)10-9-13-25(29)27(30)31/h10,16-17,21-24,26H,6-9,11-15,18-19H2,1-5H3,(H,30,31)/b17-16+,20-10+/t21-,23+,24-,26-/m1/s1 |
| InChIKey | JNHMVVJLMDPXNP-SPMIURQGSA-N |
| XLogP | 7.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|