C31H54N2O — CID 18598242
1-[1-pentyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone (PubChem CID 18598242) has the molecular formula C31H54N2O and a molecular weight of 470.79 g/mol. Its IUPAC name is 1-[1-pentyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[1-pentyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 18598242 |
| Molecular Formula | C31H54N2O |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 470.42 |
| IUPAC Name | 1-[1-pentyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
| SMILES | CCCCCN1CCN(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1C(C)=O |
| InChI | InChI=1S/C31H54N2O/c1-8-9-10-21-33-24-23-32(25-31(33)30(7)34)22-20-29(6)19-13-18-28(5)17-12-16-27(4)15-11-14-26(2)3/h14,16,18,20,31H,8-13,15,17,19,21-25H2,1-7H3/b27-16+,28-18+,29-20+ |
| InChIKey | YRORITFXBZPBAS-NHLJJDLOSA-N |
| XLogP | 7.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|