C9H8N4O4S — CID 18598719
(3R,4S)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid (PubChem CID 18598719) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is (3R,4S)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid.
| Compound Name | (3R,4S)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 18598719 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (3R,4S)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid |
| SMILES | [N-]=[N+]=N[C@H]1C(=O)N(S(=O)(=O)O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C9H8N4O4S/c10-12-11-7-8(6-4-2-1-3-5-6)13(9(7)14)18(15,16)17/h1-5,7-8H,(H,15,16,17)/t7-,8+/m1/s1 |
| InChIKey | ZOUWSJSHUCEPRU-SFYZADRCSA-N |
| XLogP | 1.05 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|