(3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid

C9H8N4O4S — CID 18598723

IUPAC(3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid
SMILES[N-]=[N+]=N[C@H]1C(=O)N(S(=O)(=O)O)[C@@H]1c1ccccc1
InChIInChI=1S/C9H8N4O4S/c10-12-11-7-8(6-4-2-1-3-5-6)13(9(7)14)18(15,16)17/h1-5,7-8H,(H,15,16,17)/t7-,8-/m1/s1
InChIKeyZOUWSJSHUCEPRU-HTQZYQBOSA-N
MW268.25 g/mol
LogP1.05
Rot. Bonds3

About (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid

(3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid (PubChem CID 18598723) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid.

Molecular Properties

Compound Name(3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid
PubChem CID18598723
Molecular FormulaC9H8N4O4S
Molecular Weight268.25 g/mol
Exact Mass268.03
IUPAC Name(3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid
SMILES[N-]=[N+]=N[C@H]1C(=O)N(S(=O)(=O)O)[C@@H]1c1ccccc1
InChIInChI=1S/C9H8N4O4S/c10-12-11-7-8(6-4-2-1-3-5-6)13(9(7)14)18(15,16)17/h1-5,7-8H,(H,15,16,17)/t7-,8-/m1/s1
InChIKeyZOUWSJSHUCEPRU-HTQZYQBOSA-N
XLogP1.05
TPSA123.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.25
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid?
The IUPAC name of (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid (CID 18598723) is (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid.
What is the SMILES notation for (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid?
The canonical SMILES for (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid is [N-]=[N+]=N[C@H]1C(=O)N(S(=O)(=O)O)[C@@H]1c1ccccc1.
What is the InChIKey of (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid?
The InChIKey is ZOUWSJSHUCEPRU-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H8N4O4S/c10-12-11-7-8(6-4-2-1-3-5-6)13(9(7)14)18(15,16)17/h1-5,7-8H,(H,15,16,17)/t7-,8-/m1/s1.
What are the key properties of (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid?
(3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid has a molecular weight of 268.25 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3-azido-2-oxo-4-phenylazetidine-1-sulfonic acid is sourced from PubChem (CID 18598723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).