C24H28N2O6 — CID 18599215
methyl 2-[(3R,4R)-3-isocyano-2-oxo-3-(2-phenylmethoxycarbonyloxypropan-2-yl)-4-prop-2-enylazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 18599215) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 2-[(3R,4R)-3-isocyano-2-oxo-3-(2-phenylmethoxycarbonyloxypropan-2-yl)-4-prop-2-enylazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[(3R,4R)-3-isocyano-2-oxo-3-(2-phenylmethoxycarbonyloxypropan-2-yl)-4-prop-2-enylazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 18599215 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | methyl 2-[(3R,4R)-3-isocyano-2-oxo-3-(2-phenylmethoxycarbonyloxypropan-2-yl)-4-prop-2-enylazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | [C-]#[N+][C@]1(C(C)(C)OC(=O)OCc2ccccc2)C(=O)N(C(C(=O)OC)=C(C)C)[C@@H]1CC=C |
| InChI | InChI=1S/C24H28N2O6/c1-8-12-18-24(25-6,21(28)26(18)19(16(2)3)20(27)30-7)23(4,5)32-22(29)31-15-17-13-10-9-11-14-17/h8-11,13-14,18H,1,12,15H2,2-5,7H3/t18-,24+/m1/s1 |
| InChIKey | BYJXJFPPBNONFV-KOSHJBKYSA-N |
| XLogP | 4.03 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|