C32H32O4 — CID 18608296
(2R,3R)-5-[3-benzyl-5-(1,1-diphenylethyl)phenoxy]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 18608296) has the molecular formula C32H32O4 and a molecular weight of 480.60 g/mol. Its IUPAC name is (2R,3R)-5-[3-benzyl-5-(1,1-diphenylethyl)phenoxy]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R)-5-[3-benzyl-5-(1,1-diphenylethyl)phenoxy]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 18608296 |
| Molecular Formula | C32H32O4 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (2R,3R)-5-[3-benzyl-5-(1,1-diphenylethyl)phenoxy]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CC(c1ccccc1)(c1ccccc1)c1cc(Cc2ccccc2)cc(OC2C[C@@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C32H32O4/c1-32(25-13-7-3-8-14-25,26-15-9-4-10-16-26)27-18-24(17-23-11-5-2-6-12-23)19-28(20-27)35-31-21-29(34)30(22-33)36-31/h2-16,18-20,29-31,33-34H,17,21-22H2,1H3/t29-,30-,31?/m1/s1 |
| InChIKey | YDRCUVHJCVXGPE-KCUXUGRMSA-N |
| XLogP | 5.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|